N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide
Modify Date: 2026-07-03 08:16:50
![N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide Structure](https://www.chemsrc.com/extcaspic/061/2034245-99-1.png)
N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide structure
|
Common Name | N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2034245-99-1 | Molecular Weight | 245.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N3O2 |
|---|---|
| Molecular Weight | 245.28 |
| InChIKey | ULIGXGNCGYJBSQ-UHFFFAOYSA-N |
| SMILES | O=C(NCc1cnn2c1CCCC2)c1ccoc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide? |
| A: The English name of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide is N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide. |
| Q: What is the SMILES notation of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide? |
| A: SMILES notation of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide is O=C(NCc1cnn2c1CCCC2)c1ccoc1. |
| Q: What is the Chinese name of 2034245-99-1? |
| A: Chinese name of 2034245-99-1 is 2034245-99-1. |
| Q: What is the InChIKey of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide? |
| A: InChIKey of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide is ULIGXGNCGYJBSQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide? |
| A: Molecular formula of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide is C13H15N3O2. |
| Q: What is the molecular weight of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide? |
| A: Molecular weight of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide is 245.28. |
| Q: What is the CAS number of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide? |
| A: CAS number of N-((4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-3-yl)methyl)furan-3-carboxamide is 2034245-99-1. |