N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide
Modify Date: 2025-09-10 02:44:54
N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide structure
|
Common Name | N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide | ||
|---|---|---|---|---|
| CAS Number | 2034282-64-7 | Molecular Weight | 414.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26N4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H26N4O4S2 |
|---|---|
| Molecular Weight | 414.5 |
| InChIKey | WSUPRNUPFKGGRJ-UHFFFAOYSA-N |
| SMILES | CSc1ccccc1NC(=O)C(=O)NCC1CCN(S(=O)(=O)N(C)C)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide? |
| A: The English name of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide is N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide. |
| Q: What is the InChIKey of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide? |
| A: InChIKey of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide is WSUPRNUPFKGGRJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide? |
| A: SMILES notation of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide is CSc1ccccc1NC(=O)C(=O)NCC1CCN(S(=O)(=O)N(C)C)CC1. |
| Q: What is the Chinese name of 2034282-64-7? |
| A: Chinese name of 2034282-64-7 is 2034282-64-7. |
| Q: What is the CAS number of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide? |
| A: CAS number of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide is 2034282-64-7. |
| Q: What is the molecular weight of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide? |
| A: Molecular weight of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide is 414.5. |
| Q: What is the molecular formula of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide? |
| A: Molecular formula of N1-((1-(N,N-dimethylsulfamoyl)piperidin-4-yl)methyl)-N2-(2-(methylthio)phenyl)oxalamide is C17H26N4O4S2. |