N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide
Modify Date: 2026-07-04 15:11:41
![N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide Structure](https://www.chemsrc.com/extcaspic/408/2034432-91-0.png)
N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide structure
|
Common Name | N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2034432-91-0 | Molecular Weight | 387.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18FN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H18FN3O3S |
|---|---|
| Molecular Weight | 387.4 |
| InChIKey | GBCAQQKVJMOWEK-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2cccnc2-c2ccncc2)cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide? |
| A: SMILES notation of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide is CCOc1ccc(S(=O)(=O)NCc2cccnc2-c2ccncc2)cc1F. |
| Q: What is the InChIKey of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide? |
| A: InChIKey of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide is GBCAQQKVJMOWEK-UHFFFAOYSA-N. |
| Q: What is the English name of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide? |
| A: The English name of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide is N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide. |
| Q: What is the molecular weight of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide? |
| A: Molecular weight of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide is 387.4. |
| Q: What is the Chinese name of 2034432-91-0? |
| A: Chinese name of 2034432-91-0 is 2034432-91-0. |
| Q: What is the molecular formula of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide? |
| A: Molecular formula of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide is C19H18FN3O3S. |
| Q: What is the CAS number of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide? |
| A: CAS number of N-([2,4'-bipyridin]-3-ylmethyl)-4-ethoxy-3-fluorobenzenesulfonamide is 2034432-91-0. |