1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea
Modify Date: 2025-08-23 00:39:42
1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea structure
|
Common Name | 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea | ||
|---|---|---|---|---|
| CAS Number | 2034440-79-2 | Molecular Weight | 373.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20ClN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20ClN3O4S |
|---|---|
| Molecular Weight | 373.9 |
| InChIKey | IHRFJIFSYSAIJH-UHFFFAOYSA-N |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(Cl)c(N2CCCS2(=O)=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea? |
| A: CAS number of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea is 2034440-79-2. |
| Q: What is the InChIKey of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea? |
| A: InChIKey of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea is IHRFJIFSYSAIJH-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea? |
| A: The English name of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea is 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea. |
| Q: What is the molecular formula of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea? |
| A: Molecular formula of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea is C15H20ClN3O4S. |
| Q: What is the SMILES notation of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea? |
| A: SMILES notation of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea is O=C(NCC1CCCO1)Nc1ccc(Cl)c(N2CCCS2(=O)=O)c1. |
| Q: What is the Chinese name of 2034440-79-2? |
| A: Chinese name of 2034440-79-2 is 2034440-79-2. |
| Q: What is the molecular weight of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea? |
| A: Molecular weight of 1-(4-Chloro-3-(1,1-dioxidoisothiazolidin-2-yl)phenyl)-3-((tetrahydrofuran-2-yl)methyl)urea is 373.9. |