N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide
Modify Date: 2026-07-04 12:59:00
![N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide Structure](https://www.chemsrc.com/extcaspic/470/2034475-11-9.png)
N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide structure
|
Common Name | N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 2034475-11-9 | Molecular Weight | 359.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17N3O2S2 |
|---|---|
| Molecular Weight | 359.5 |
| InChIKey | GKGVGSMTKRTAIM-UHFFFAOYSA-N |
| SMILES | CCc1ccc(S(=O)(=O)NCc2cccnc2-c2ccncc2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide? |
| A: InChIKey of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide is GKGVGSMTKRTAIM-UHFFFAOYSA-N. |
| Q: What is the English name of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide? |
| A: The English name of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide is N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide. |
| Q: What is the CAS number of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide? |
| A: CAS number of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide is 2034475-11-9. |
| Q: What is the SMILES notation of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide? |
| A: SMILES notation of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide is CCc1ccc(S(=O)(=O)NCc2cccnc2-c2ccncc2)s1. |
| Q: What is the Chinese name of 2034475-11-9? |
| A: Chinese name of 2034475-11-9 is 2034475-11-9. |
| Q: What is the molecular weight of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide? |
| A: Molecular weight of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide is 359.5. |
| Q: What is the molecular formula of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide? |
| A: Molecular formula of N-([2,4'-bipyridin]-3-ylmethyl)-5-ethylthiophene-2-sulfonamide is C17H17N3O2S2. |