1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea
Modify Date: 2026-07-13 19:11:31
![1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea Structure](https://www.chemsrc.com/extcaspic/051/2034489-16-0.png)
1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea structure
|
Common Name | 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea | ||
|---|---|---|---|---|
| CAS Number | 2034489-16-0 | Molecular Weight | 264.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O4 |
|---|---|
| Molecular Weight | 264.28 |
| InChIKey | GOBGZBNEKXQLDB-UHFFFAOYSA-N |
| SMILES | COCCNC(=O)NCc1ccc(-c2ccoc2)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea? |
| A: Molecular weight of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea is 264.28. |
| Q: What is the English name of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea? |
| A: The English name of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea is 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea. |
| Q: What is the CAS number of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea? |
| A: CAS number of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea is 2034489-16-0. |
| Q: What is the InChIKey of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea? |
| A: InChIKey of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea is GOBGZBNEKXQLDB-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea? |
| A: SMILES notation of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea is COCCNC(=O)NCc1ccc(-c2ccoc2)o1. |
| Q: What is the molecular formula of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea? |
| A: Molecular formula of 1-([2,3'-Bifuran]-5-ylmethyl)-3-(2-methoxyethyl)urea is C13H16N2O4. |
| Q: What is the Chinese name of 2034489-16-0? |
| A: Chinese name of 2034489-16-0 is 2034489-16-0. |