1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane
Modify Date: 2025-10-15 22:14:03
1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane structure
|
Common Name | 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane | ||
|---|---|---|---|---|
| CAS Number | 2034489-79-5 | Molecular Weight | 416.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21FN4O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21FN4O4S2 |
|---|---|
| Molecular Weight | 416.5 |
| InChIKey | PKKHJTWKTKIQSC-UHFFFAOYSA-N |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)N1CCCN(S(=O)(=O)c2cnn(C)c2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2034489-79-5? |
| A: Chinese name of 2034489-79-5 is 2034489-79-5. |
| Q: What is the English name of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane? |
| A: The English name of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane is 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane. |
| Q: What is the molecular formula of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane? |
| A: Molecular formula of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane is C16H21FN4O4S2. |
| Q: What is the molecular weight of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane? |
| A: Molecular weight of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane is 416.5. |
| Q: What is the SMILES notation of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane? |
| A: SMILES notation of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane is Cc1cc(F)ccc1S(=O)(=O)N1CCCN(S(=O)(=O)c2cnn(C)c2)CC1. |
| Q: What is the InChIKey of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane? |
| A: InChIKey of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane is PKKHJTWKTKIQSC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane? |
| A: CAS number of 1-((4-fluoro-2-methylphenyl)sulfonyl)-4-((1-methyl-1H-pyrazol-4-yl)sulfonyl)-1,4-diazepane is 2034489-79-5. |