Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate
Modify Date: 2026-09-27 17:43:49
![Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate Structure](https://www.chemsrc.com/extcaspic/416/2034495-75-3.png)
Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate structure
|
Common Name | Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2034495-75-3 | Molecular Weight | 267.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13NO2S2 |
|---|---|
| Molecular Weight | 267.4 |
| InChIKey | KSLCMBLKWPZAFX-UHFFFAOYSA-N |
| SMILES | COC(=O)NCCc1ccc(-c2ccsc2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate? |
| A: InChIKey of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate is KSLCMBLKWPZAFX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate? |
| A: SMILES notation of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate is COC(=O)NCCc1ccc(-c2ccsc2)s1. |
| Q: What is the molecular weight of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate? |
| A: Molecular weight of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate is 267.4. |
| Q: What is the molecular formula of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate? |
| A: Molecular formula of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate is C12H13NO2S2. |
| Q: What is the CAS number of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate? |
| A: CAS number of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate is 2034495-75-3. |
| Q: What is the English name of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate? |
| A: The English name of Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate is Methyl (2-([2,3'-bithiophen]-5-yl)ethyl)carbamate. |
| Q: What is the Chinese name of 2034495-75-3? |
| A: Chinese name of 2034495-75-3 is 2034495-75-3. |