N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide
Modify Date: 2026-08-29 13:56:41
![N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide Structure](https://www.chemsrc.com/extcaspic/211/2034603-37-5.png)
N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide structure
|
Common Name | N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide | ||
|---|---|---|---|---|
| CAS Number | 2034603-37-5 | Molecular Weight | 362.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22N2O3 |
|---|---|
| Molecular Weight | 362.4 |
| InChIKey | KQYKUZJXPKRUHK-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(NC(=O)C(=O)NCc2ccc(-c3ccoc3)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide? |
| A: SMILES notation of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide is CC(C)c1ccc(NC(=O)C(=O)NCc2ccc(-c3ccoc3)cc2)cc1. |
| Q: What is the InChIKey of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide? |
| A: InChIKey of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide is KQYKUZJXPKRUHK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2034603-37-5? |
| A: Chinese name of 2034603-37-5 is 2034603-37-5. |
| Q: What is the English name of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide? |
| A: The English name of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide is N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide. |
| Q: What is the CAS number of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide? |
| A: CAS number of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide is 2034603-37-5. |
| Q: What is the molecular formula of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide? |
| A: Molecular formula of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide is C22H22N2O3. |
| Q: What is the molecular weight of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide? |
| A: Molecular weight of N-{[4-(furan-3-yl)phenyl]methyl}-N'-[4-(propan-2-yl)phenyl]ethanediamide is 362.4. |