5-chloro-2-nitrocinnamic acid structure
|
Common Name | 5-chloro-2-nitrocinnamic acid | ||
|---|---|---|---|---|
| CAS Number | 20357-28-2 | Molecular Weight | 227.60100 | |
| Density | 1.529 g/cm3 | Boiling Point | 417.2ºC at 760 mmHg | |
| Molecular Formula | C9H6ClNO4 | Melting Point | 174-175ºC | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | 5-chloro-2-nitrocinnamic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.529 g/cm3 |
|---|---|
| Boiling Point | 417.2ºC at 760 mmHg |
| Melting Point | 174-175ºC |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60100 |
| Flash Point | 206.1ºC |
| Exact Mass | 226.99900 |
| PSA | 83.12000 |
| LogP | 2.86920 |
| Vapour Pressure | 1.05E-07mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | PXHIUBAKYZFXKE-DAFODLJHSA-N |
| SMILES | O=C(O)C=Cc1cc(Cl)ccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Chlor-o-nitrozimtsaeure |
| 5-chloro-2-nitro-cinnamic acid |
| RARECHEM BK HW 0229 |
| 5-Chlor-2-nitro-zimtsaeure |