5-chloro-2-nitrocinnamic acid
5-chloro-2-nitrocinnamic acid structure
|
Common Name | 5-chloro-2-nitrocinnamic acid | ||
|---|---|---|---|---|
| CAS Number | 20357-28-2 | Molecular Weight | 227.60100 | |
| Density | 1.529 g/cm3 | Boiling Point | 417.2ºC at 760 mmHg | |
| Molecular Formula | C9H6ClNO4 | Melting Point | 174-175ºC | |
| MSDS | N/A | Flash Point | 206.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-chloro-2-nitrocinnamic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.529 g/cm3 |
|---|---|
| Boiling Point | 417.2ºC at 760 mmHg |
| Melting Point | 174-175ºC |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60100 |
| Flash Point | 206.1ºC |
| Exact Mass | 226.99900 |
| PSA | 83.12000 |
| LogP | 2.86920 |
| Vapour Pressure | 1.05E-07mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | PXHIUBAKYZFXKE-DAFODLJHSA-N |
| SMILES | O=C(O)C=Cc1cc(Cl)ccc1[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:860687-65-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-Chlor-o-nitrozimtsaeure |
| 5-chloro-2-nitro-cinnamic acid |
| RARECHEM BK HW 0229 |
| 5-Chlor-2-nitro-zimtsaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 5-chloro-2-nitrocinnamic acid have? |
| A: English synonyms of 5-chloro-2-nitrocinnamic acid: 5-Chlor-o-nitrozimtsaeure, 5-chloro-2-nitro-cinnamic acid, RARECHEM BK HW 0229, 5-Chlor-2-nitro-zimtsaeure. |
| Q: What is the molecular formula of 5-chloro-2-nitrocinnamic acid? |
| A: Molecular formula of 5-chloro-2-nitrocinnamic acid is C9H6ClNO4. |
| Q: What is the SMILES notation of 5-chloro-2-nitrocinnamic acid? |
| A: SMILES notation of 5-chloro-2-nitrocinnamic acid is O=C(O)C=Cc1cc(Cl)ccc1[N+](=O)[O-]. |
| Q: What is the LogP of 5-chloro-2-nitrocinnamic acid? |
| A: LogP of 5-chloro-2-nitrocinnamic acid is 2.86920. |
| Q: What is the CAS number of 5-chloro-2-nitrocinnamic acid? |
| A: CAS number of 5-chloro-2-nitrocinnamic acid is 20357-28-2. |
| Q: What is the polar surface area (PSA) of 5-chloro-2-nitrocinnamic acid? |
| A: Polar surface area (PSA) of 5-chloro-2-nitrocinnamic acid is 83.12000. |
| Q: What is the molecular weight of 5-chloro-2-nitrocinnamic acid? |
| A: Molecular weight of 5-chloro-2-nitrocinnamic acid is 227.60100. |
| Q: What is the melting point of 5-chloro-2-nitrocinnamic acid? |
| A: Melting point of 5-chloro-2-nitrocinnamic acid is 174-175ºC. |
| Q: What is the boiling point of 5-chloro-2-nitrocinnamic acid? |
| A: Boiling point of 5-chloro-2-nitrocinnamic acid is 417.2ºC at 760 mmHg. |
| Q: What are the downstream products of 5-chloro-2-nitrocinnamic acid? |
| A: Related downstream products(CAS) of 5-chloro-2-nitrocinnamic acid: 860687-65-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |