7,8-DICHLORO-2-METHYLQUINOLIN-4(1H)-ONE structure
|
Common Name | 7,8-DICHLORO-2-METHYLQUINOLIN-4(1H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 203626-50-0 | Molecular Weight | 228.07500 | |
| Density | 1.467g/cm3 | Boiling Point | 382ºC at 760 mmHg | |
| Molecular Formula | C10H7Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | 7,8-dichloro-2-methyl-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 382ºC at 760 mmHg |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.07500 |
| Flash Point | 184.9ºC |
| Exact Mass | 226.99000 |
| PSA | 33.12000 |
| LogP | 3.55560 |
| Vapour Pressure | 2.21E-06mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | HVAIYUWIVFOCLU-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)c2ccc(Cl)c(Cl)c2[nH]1 |
|
~84%
7,8-DICHLORO-2-... CAS#:203626-50-0 |
| Literature: Sapkal, Suryakant B.; Shelke, Kiran F.; Shingate, Bapurao B.; Shingare, Murlidhar S. Journal of the Korean Chemical Society, 2010 , vol. 54, # 6 p. 723 - 726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7,8-Dichloro-2-methyl-4-quinolinol |
| 7,8-Dichloro-4-hydroxy-2-methylquinoline |