(5-acetyloxy-3,7-dimethyl-1-adamantyl) acetate structure
|
Common Name | (5-acetyloxy-3,7-dimethyl-1-adamantyl) acetate | ||
|---|---|---|---|---|
| CAS Number | 20366-07-8 | Molecular Weight | 280.35900 | |
| Density | 1.14g/cm3 | Boiling Point | 317.8ºC at 760mmHg | |
| Molecular Formula | C16H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.3ºC | |
| Name | (3-acetyloxy-5,7-dimethyl-1-adamantyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 317.8ºC at 760mmHg |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.35900 |
| Flash Point | 146.3ºC |
| Exact Mass | 280.16700 |
| PSA | 52.60000 |
| LogP | 2.98420 |
| Vapour Pressure | 0.000377mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | CUZHDLZZCCPIFX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC12CC3(C)CC(C)(C1)CC(OC(C)=O)(C3)C2 |
|
~10%
(5-acetyloxy-3,... CAS#:20366-07-8 |
| Literature: Tashiro, Daisuke; Kawasaki, Yumi; Sakaguchi, Satoshi; Ishii, Yasutaka Journal of Organic Chemistry, 1997 , vol. 62, # 23 p. 8141 - 8144 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Diacetoxy-5,7-dimethyl-adamantan |