N-(2-nitro-4-propoxyphenyl)acetamide structure
|
Common Name | N-(2-nitro-4-propoxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 20367-33-3 | Molecular Weight | 238.24000 | |
| Density | 1.244g/cm3 | Boiling Point | 444.8ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8ºC | |
| Name | N-(2-nitro-4-propoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 444.8ºC at 760 mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24000 |
| Flash Point | 222.8ºC |
| Exact Mass | 238.09500 |
| PSA | 87.64000 |
| LogP | 3.51470 |
| Vapour Pressure | 4.15E-08mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | SCCDPJHRMIEZGA-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(NC(C)=O)c([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(2-nitro-4-pr... CAS#:20367-33-3 |
| Literature: Verkade; Witjens Recueil des Travaux Chimiques des Pays-Bas, 1946 , vol. 65, p. 361,378 Recueil des Travaux Chimiques des Pays-Bas, 1943 , vol. 62, p. 203 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Propoxy-2-nitroacetanilid |
| EINECS 243-767-9 |