3-(2,4-Dimethylbenzoyl)-N-(3-hydroxypropyl)propionamide structure
|
Common Name | 3-(2,4-Dimethylbenzoyl)-N-(3-hydroxypropyl)propionamide | ||
|---|---|---|---|---|
| CAS Number | 20381-03-7 | Molecular Weight | 263.33200 | |
| Density | 1.099g/cm3 | Boiling Point | 517.6ºC at 760 mmHg | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.8ºC | |
| Name | 4-(2,4-dimethylphenyl)-N-(3-hydroxypropyl)-4-oxobutanamide |
|---|
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 517.6ºC at 760 mmHg |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33200 |
| Flash Point | 266.8ºC |
| Exact Mass | 263.15200 |
| PSA | 69.89000 |
| LogP | 2.60520 |
| Vapour Pressure | 1.54E-11mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | HOCXBMREALVPID-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CCC(=O)NCCCO)c(C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |