bis(anilinomethyl)phosphinic acid structure
|
Common Name | bis(anilinomethyl)phosphinic acid | ||
|---|---|---|---|---|
| CAS Number | 20384-96-7 | Molecular Weight | 276.27100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(anilinomethyl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H17N2O2P |
|---|---|
| Molecular Weight | 276.27100 |
| Exact Mass | 276.10300 |
| PSA | 71.17000 |
| LogP | 3.54200 |
| InChIKey | YKODTVFYQVOXIS-UHFFFAOYSA-N |
| SMILES | O=P(O)(CNc1ccccc1)CNc1ccccc1 |
|
~%
bis(anilinometh... CAS#:20384-96-7 |
| Literature: Il'ina,M.K.; Shermergon,I.M. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1968 , p. 1759 - 1761 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1968 , # 8 p. 1860 - 1862 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Bis-anilinomethyl-phosphinsaeure |