Fmoc-β-HomoLys(Boc)-OH structure
|
Common Name | Fmoc-β-HomoLys(Boc)-OH | ||
|---|---|---|---|---|
| CAS Number | 203854-47-1 | Molecular Weight | 482.569 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 696.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H34N2O6 | Melting Point | 96℃ | |
| MSDS | Chinese USA | Flash Point | 374.8±31.5 °C | |
| Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 696.2±55.0 °C at 760 mmHg |
| Melting Point | 96℃ |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.569 |
| Flash Point | 374.8±31.5 °C |
| Exact Mass | 482.241699 |
| PSA | 113.96000 |
| LogP | 5.13 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | SDBUQLGECIYUDT-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(CC(=O)O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Water Solubility | Sparingly soluble bin water. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~83%
Fmoc-β-HomoLys(... CAS#:203854-47-1 |
| Literature: Guichard, Gilles; Abele, Stefan; Seebach, Dieter Helvetica Chimica Acta, 1998 , vol. 81, # 2 p. 187 - 206 |
|
~%
Fmoc-β-HomoLys(... CAS#:203854-47-1 |
| Literature: Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, , vol. 42, # 7 p. 1691 - 1695 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Fmoc-β-Homolys(Boc)-OH |
| MFCD01863054 |
| (S)-7-{[(tert-butoxy)carbonyl]amino}-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid |
| (S)-7-(Boc-amino)-3-(Fmoc-amino)heptanoic acid |
| (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-7-((tert-butoxycarbonyl)amino)heptanoic acid |
| Fmoc-|A-HoTrp(Boc)-OH |
| (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)heptanoic acid |
| (3S)-7-[(tert-Butoxycarbonyl)amino]-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}heptanoic acid |
| Heptanoic acid, 7-[[(1,1-dimethylethoxy)carbonyl]amino]-3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (3S)- |