1-oxido-2-phenylquinolin-1-ium-4-carboxylic acid structure
|
Common Name | 1-oxido-2-phenylquinolin-1-ium-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 20389-12-2 | Molecular Weight | 265.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-oxido-2-phenylquinolin-1-ium-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11NO3 |
|---|---|
| Molecular Weight | 265.26300 |
| Exact Mass | 265.07400 |
| PSA | 62.76000 |
| LogP | 3.63350 |
| InChIKey | MELZYSXVKYEMGC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccccc2)[n+]([O-])c2ccccc12 |
|
~%
1-oxido-2-pheny... CAS#:20389-12-2 |
| Literature: Kaneko; Fujii; Kawai; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 4 p. 1157 - 1171 |
|
~%
1-oxido-2-pheny... CAS#:20389-12-2 |
| Literature: Kaneko; Fujii; Kawai; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 4 p. 1157 - 1171 |
|
~%
Detail
|
| Literature: Chalezkii et al. Zhurnal Obshchei Khimii, 1958 , vol. 28, p. 2355,2358; engl. Ausg. S. 2393, 2395 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
| 4-Quinolinecarboxylic acid,2-phenyl-,1-oxide |
| 2-Phenyl-chinolin-4-carbonsaeure-N-oxid |
| 2-Phenyl-4-quinolinecarboxylic acid 1-oxide |
| 1-oxy-2-phenyl-quinoline-4-carboxylic acid |
| 2-Phenyl-chinolin-4-carbonsaeure-1-oxid |
| 2-Phenylquinoline-4-carboxylic acid N-oxide |
| 2-phenylquinoline 1-oxide-4-carboxylic acid |
| 2-phenyl-quinoline-4-carboxylic acid-1-oxide |