1-[(ethoxy-ethyl-phosphoryl)sulfanylmethylsulfanylmethylsulfanyl-ethyl-phosphoryl]oxyethane structure
|
Common Name | 1-[(ethoxy-ethyl-phosphoryl)sulfanylmethylsulfanylmethylsulfanyl-ethyl-phosphoryl]oxyethane | ||
|---|---|---|---|---|
| CAS Number | 20395-17-9 | Molecular Weight | 366.43800 | |
| Density | 1.235g/cm3 | Boiling Point | 421.7ºC at 760mmHg | |
| Molecular Formula | C10H24O4P2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.9ºC | |
| Name | 1-[[ethoxy(ethyl)phosphoryl]sulfanylmethylsulfanylmethylsulfanyl-ethylphosphoryl]oxyethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 421.7ºC at 760mmHg |
| Molecular Formula | C10H24O4P2S3 |
| Molecular Weight | 366.43800 |
| Flash Point | 208.9ºC |
| Exact Mass | 366.03100 |
| PSA | 148.12000 |
| LogP | 5.60000 |
| Vapour Pressure | 6.24E-07mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | FHSNIKKZEFCKFD-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC)SCSCSP(=O)(CC)OCC |
| HS Code | 2930909027 |
|---|
| HS Code | 2930909027 |
|---|---|
| Summary | 2930909027 。supervision conditions:23(import license for dual-use item and technologies,export license for dual-use item and technologies)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| ENT 27,083 |
| Stauffer N-3736 |
| N 3736 |