4-(1-CBZ-PIPERIDIN-4-YL)-BUTYRICACID structure
|
Common Name | 4-(1-CBZ-PIPERIDIN-4-YL)-BUTYRICACID | ||
|---|---|---|---|---|
| CAS Number | 204139-61-7 | Molecular Weight | 305.36900 | |
| Density | 1.169g/cm3 | Boiling Point | 480ºC at 760mmHg | |
| Molecular Formula | C17H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.1ºC | |
| Name | 4-(1-phenylmethoxycarbonylpiperidin-4-yl)butanoic acid |
|---|
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 480ºC at 760mmHg |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.36900 |
| Flash Point | 244.1ºC |
| Exact Mass | 305.16300 |
| PSA | 66.84000 |
| LogP | 3.22800 |
| Vapour Pressure | 5.04E-10mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | BZRPDNDVXWLKCX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCC1CCN(C(=O)OCc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |