3-Methyl-3-nitronorbornan-2-one O-(methylcarbamoyl)oxime structure
|
Common Name | 3-Methyl-3-nitronorbornan-2-one O-(methylcarbamoyl)oxime | ||
|---|---|---|---|---|
| CAS Number | 20417-92-9 | Molecular Weight | 241.24400 | |
| Density | 1.519g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(Z)-(3-methyl-3-nitro-2-bicyclo[2.2.1]heptanylidene)amino] N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.519g/cm3 |
|---|---|
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.24400 |
| Exact Mass | 241.10600 |
| PSA | 100.00000 |
| LogP | 1.89130 |
| Index of Refraction | 1.647 |
| InChIKey | ZIAJZEAOGKWGJQ-WQLSENKSSA-N |
| SMILES | CNC(=O)ON=C1C2CCC(C2)C1(C)[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methyl-2-nitrobicyclo<2.2.1>heptan-3-on-N-methylcarbamoyloxim |
| ENT 27,301 |