(E)-[4-(Acetylthio)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-piperidinylidene]acetic Acid Ethyl Ester (Mixture of Diastereomers) structure
|
Common Name | (E)-[4-(Acetylthio)-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-3-piperidinylidene]acetic Acid Ethyl Ester (Mixture of Diastereomers) | ||
|---|---|---|---|---|
| CAS Number | 204206-08-6 | Molecular Weight | 419.51000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (2E)-2-[4-acetylsulfanyl-1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]piperidin-3-ylidene]acetate |
|---|
| Molecular Formula | C22H26FNO4S |
|---|---|
| Molecular Weight | 419.51000 |
| Exact Mass | 419.15700 |
| PSA | 88.98000 |
| LogP | 3.62730 |
| InChIKey | YLDYDAMEIDTDLR-FOWTUZBSSA-N |
| SMILES | CCOC(=O)C=C1CN(C(C(=O)C2CC2)c2ccccc2F)CCC1SC(C)=O |