Buthiazide structure
|
Common Name | Buthiazide | ||
|---|---|---|---|---|
| CAS Number | 2043-38-1 | Molecular Weight | 353.84500 | |
| Density | 1.433g/cm3 | Boiling Point | 562.7ºC at 760mmHg | |
| Molecular Formula | C11H16ClN3O4S2 | Melting Point | 214-217ºC | |
| MSDS | N/A | Flash Point | 294.1ºC | |
Use of ButhiazideButhiazide, also known as Butizide, is a 3-isobutyl analog of hydrochlorothiazide. |
| Name | 6-chloro-3-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 562.7ºC at 760mmHg |
| Melting Point | 214-217ºC |
| Molecular Formula | C11H16ClN3O4S2 |
| Molecular Weight | 353.84500 |
| Flash Point | 294.1ºC |
| Exact Mass | 353.02700 |
| PSA | 135.12000 |
| LogP | 4.39210 |
| Vapour Pressure | 1.09E-12mmHg at 25°C |
| Index of Refraction | 1.572 |
| InChIKey | HGBFRHCDYZJRAO-UHFFFAOYSA-N |
| SMILES | CC(C)CC1Nc2cc(Cl)c(S(N)(=O)=O)cc2S(=O)(=O)N1 |
| 6-chloro-3,4-dihydro-3-(2-methylpropyl)-2H-1,2,4-benzothiadiazine-7-sulfonamide |
| Buthiazide |
| Saltucin |
| Eunephran |
| Butizidum [INN-Latin] |
| BUTHIAZIDE |
| thiabutazide |
| Butizida |
| isobutylhydrochlorothiazide |