Bis(4-methoxyphenyl)phosphinic acid
Modify Date: 2025-08-23 16:49:25
Bis(4-methoxyphenyl)phosphinic acid structure
|
Common Name | Bis(4-methoxyphenyl)phosphinic acid | ||
|---|---|---|---|---|
| CAS Number | 20434-05-3 | Molecular Weight | 278.24000 | |
| Density | 1.27g/cm3 | Boiling Point | 504.1ºC at 760 mmHg | |
| Molecular Formula | C14H15O4P | Melting Point | 185-187ºC(lit.) | |
| MSDS | USA | Flash Point | 258.7ºC | |
| Name | Bis(4-methoxyphenyl)phosphinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 504.1ºC at 760 mmHg |
| Melting Point | 185-187ºC(lit.) |
| Molecular Formula | C14H15O4P |
| Molecular Weight | 278.24000 |
| Flash Point | 258.7ºC |
| Exact Mass | 278.07100 |
| PSA | 65.57000 |
| LogP | 1.92500 |
| Vapour Pressure | 5.55E-11mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | BFPBWJGVRNQWEK-UHFFFAOYSA-N |
| SMILES | COc1ccc(P(=O)(O)c2ccc(OC)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Improved performance of porphyrin-based dye sensitised solar cells by phosphinic acid surface treatment.
Energy Environ. Sci. 2(10) , 1069-1073, (2009)
|
| di(p-methoxyphenyl)phosphinic acid |
| Bis-(4-methoxy-phenyl)-phosphinsaeure |
| MFCD00010226 |
| bis-p-methoxyphenylphosphinic acid |
| di-p-anisylphosphinic acid |
| bis(p-methoxyphenyl)phosphonic acid |
| bis-(4-methoxy-phenyl)-phosphinic acid |