2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate structure
|
Common Name | 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 2044272-36-6 | Molecular Weight | 235.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H9N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H9N3O5S |
|---|---|
| Molecular Weight | 235.22 |
| InChIKey | VCAVNJOBZWXGNN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCn1ccc([N+](=O)[O-])n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate? |
| A: InChIKey of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate is VCAVNJOBZWXGNN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate? |
| A: CAS number of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate is 2044272-36-6. |
| Q: What is the molecular formula of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate? |
| A: Molecular formula of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate is C6H9N3O5S. |
| Q: What is the Chinese name of 2044272-36-6? |
| A: Chinese name of 2044272-36-6 is 2044272-36-6. |
| Q: What is the SMILES notation of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate? |
| A: SMILES notation of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate is CS(=O)(=O)OCCn1ccc([N+](=O)[O-])n1. |
| Q: What is the molecular weight of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate? |
| A: Molecular weight of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate is 235.22. |
| Q: What is the English name of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate? |
| A: The English name of 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate is 2-(3-nitro-1H-pyrazol-1-yl)ethyl methanesulfonate. |