Sodium 2-(hydroxymethyl)isonicotinate
Modify Date: 2025-09-09 20:45:55
Sodium 2-(hydroxymethyl)isonicotinate structure
|
Common Name | Sodium 2-(hydroxymethyl)isonicotinate | ||
|---|---|---|---|---|
| CAS Number | 2044705-26-0 | Molecular Weight | 175.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6NNaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 2-(hydroxymethyl)isonicotinate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6NNaO3 |
|---|---|
| Molecular Weight | 175.12 |
| InChIKey | DEGCZISWPZEQGJ-UHFFFAOYSA-M |
| SMILES | O=C([O-])c1ccnc(CO)c1.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2044705-26-0? |
| A: Chinese name of 2044705-26-0 is 2044705-26-0. |
| Q: What is the SMILES notation of Sodium 2-(hydroxymethyl)isonicotinate? |
| A: SMILES notation of Sodium 2-(hydroxymethyl)isonicotinate is O=C([O-])c1ccnc(CO)c1.[Na+]. |
| Q: What is the InChIKey of Sodium 2-(hydroxymethyl)isonicotinate? |
| A: InChIKey of Sodium 2-(hydroxymethyl)isonicotinate is DEGCZISWPZEQGJ-UHFFFAOYSA-M. |
| Q: What is the CAS number of Sodium 2-(hydroxymethyl)isonicotinate? |
| A: CAS number of Sodium 2-(hydroxymethyl)isonicotinate is 2044705-26-0. |
| Q: What is the molecular weight of Sodium 2-(hydroxymethyl)isonicotinate? |
| A: Molecular weight of Sodium 2-(hydroxymethyl)isonicotinate is 175.12. |
| Q: What is the molecular formula of Sodium 2-(hydroxymethyl)isonicotinate? |
| A: Molecular formula of Sodium 2-(hydroxymethyl)isonicotinate is C7H6NNaO3. |
| Q: What is the English name of Sodium 2-(hydroxymethyl)isonicotinate? |
| A: The English name of Sodium 2-(hydroxymethyl)isonicotinate is Sodium 2-(hydroxymethyl)isonicotinate. |