9H-Fluorene-9-sulfonylchloride structure
|
Common Name | 9H-Fluorene-9-sulfonylchloride | ||
|---|---|---|---|---|
| CAS Number | 20449-15-4 | Molecular Weight | 264.72700 | |
| Density | 1.47g/cm3 | Boiling Point | 429.1ºC at 760mmHg | |
| Molecular Formula | C13H9ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.3ºC | |
| Name | 9H-fluorene-9-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760mmHg |
| Molecular Formula | C13H9ClO2S |
| Molecular Weight | 264.72700 |
| Flash Point | 213.3ºC |
| Exact Mass | 264.00100 |
| PSA | 42.52000 |
| LogP | 4.40580 |
| Vapour Pressure | 3.61E-07mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | USFBRRNXUMSLSM-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)C1c2ccccc2-c2ccccc21 |
| HS Code | 2904909090 |
|---|
|
~%
9H-Fluorene-9-s... CAS#:20449-15-4 |
| Literature: Dupriest; Mark T. Patent: US4968809 A1, 1990 ; US 4968809 A |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 9H-Fluorene-9-sulfonylchloride |
| 9-fluorenylsulfonyl chloride |
| Fluorene-9-sulfonyl chloride |
| 9-Fluorensulfonylchlorid |
| fluorene-9-sulphonyl chloride |