(5-ethyl-5-nitro-2-oxo-1,3-dioxa-2$l^C12H13N2O9P-phosphacyclohex-2-yl) 4-nitrobenzoate structure
|
Common Name | (5-ethyl-5-nitro-2-oxo-1,3-dioxa-2$l^C12H13N2O9P-phosphacyclohex-2-yl) 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 20457-77-6 | Molecular Weight | 360.21300 | |
| Density | 1.53g/cm3 | Boiling Point | 504.7ºC at 760 mmHg | |
| Molecular Formula | C12H13N2O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259ºC | |
| Name | (5-ethyl-5-nitro-2-oxo-1,3,2$l^{5}-dioxaphosphinan-2-yl) 4-nitrobenzoate |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 504.7ºC at 760 mmHg |
| Molecular Formula | C12H13N2O9P |
| Molecular Weight | 360.21300 |
| Flash Point | 259ºC |
| Exact Mass | 360.03600 |
| PSA | 163.28000 |
| LogP | 3.37840 |
| Vapour Pressure | 2.6E-10mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | YGSBMHNLWFAGEE-UHFFFAOYSA-N |
| SMILES | CCC1([N+](=O)[O-])COP(=O)(OC(=O)c2ccc([N+](=O)[O-])cc2)OC1 |
|
~%
(5-ethyl-5-nitr... CAS#:20457-77-6 |
| Literature: Billman; May; Heard Journal of pharmaceutical sciences, 1968 , vol. 57, # 9 p. 1622 - 1625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |