2-chloro-N-(2-methylquinolin-4-yl)acetamide structure
|
Common Name | 2-chloro-N-(2-methylquinolin-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 204587-07-5 | Molecular Weight | 234.68200 | |
| Density | 1.322g/cm3 | Boiling Point | 439.8ºC at 760 mmHg | |
| Molecular Formula | C12H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.8ºC | |
| Name | 2-chloro-N-(2-methylquinolin-4-yl)acetamide |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 439.8ºC at 760 mmHg |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.68200 |
| Flash Point | 219.8ºC |
| Exact Mass | 234.05600 |
| PSA | 41.99000 |
| LogP | 2.79350 |
| Vapour Pressure | 6.21E-08mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | RTKWUKZLDHRJIY-UHFFFAOYSA-N |
| SMILES | Cc1cc(NC(=O)CCl)c2ccccc2n1 |
| HS Code | 2933499090 |
|---|
|
~59%
2-chloro-N-(2-m... CAS#:204587-07-5 |
| Literature: Gunnlaugsson; Mac Donaill; Parker Journal of the American Chemical Society, 2001 , vol. 123, # 51 p. 12866 - 12876 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |