1-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-3-phenyl-urea structure
|
Common Name | 1-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-3-phenyl-urea | ||
|---|---|---|---|---|
| CAS Number | 2046-44-8 | Molecular Weight | 294.30800 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-oxo-1-phenyl-4H-pyrazol-3-yl)-3-phenylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.30800 |
| Exact Mass | 294.11200 |
| PSA | 73.80000 |
| LogP | 2.52300 |
| Index of Refraction | 1.667 |
| InChIKey | CKZPYQNHZOAVBK-UHFFFAOYSA-N |
| SMILES | O=C(NC1=NN(c2ccccc2)C(=O)C1)Nc1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(5-oxo-1-phenyl-4,5-dihydro-1H-pyrazol-3-yl)-1-phenylurea |
| 1-(5-oxo-1-phenyl-4,5-dihydro-1H-pyrazol-3-yl)-3-phenyl-urea |