Gitaloxigenin + zuckerkette wie bei lanatosid A [German] structure
|
Common Name | Gitaloxigenin + zuckerkette wie bei lanatosid A [German] | ||
|---|---|---|---|---|
| CAS Number | 20460-30-4 | Molecular Weight | 1013.13000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H76O21 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Gitaloxigenin + zuckerkette wie bei lanatosid A [German]Lanatoside E is a cyclic triterpene saponin with antitumor activity[1]. |
| Name | lanatoside-E |
|---|---|
| Synonym | More Synonyms |
| Description | Lanatoside E is a cyclic triterpene saponin with antitumor activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C50H76O21 |
|---|---|
| Molecular Weight | 1013.13000 |
| Exact Mass | 1012.49000 |
| PSA | 294.35000 |
| LogP | 1.42970 |
| InChIKey | YMKWEJBJAVBYHU-SBTGRVASSA-N |
| SMILES | CC(=O)OC1CC(OC2C(O)CC(OC3C(O)CC(OC4CCC5(C)C(CCC6C5CCC5(C)C(C7=CC(=O)OC7)C(OC=O)CC65O)C4)OC3C)OC2C)OC(C)C1OC1OC(CO)C(O)C(O)C1O |
| Lanatosid-E |