1-cyclohexyl-3-(3,4-dichlorophenyl)urea structure
|
Common Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 20461-04-5 | Molecular Weight | 287.18500 | |
| Density | 1.29g/cm3 | Boiling Point | 385.9ºC at 760 mmHg | |
| Molecular Formula | C13H16Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | 1-cyclohexyl-3-(3,4-dichlorophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 385.9ºC at 760 mmHg |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.18500 |
| Flash Point | 187.2ºC |
| Exact Mass | 286.06400 |
| PSA | 41.13000 |
| LogP | 4.91150 |
| Vapour Pressure | 3.68E-06mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | CTQQFHWHCWJZON-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NC1CCCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Urea,N-cyclohexyl-N'-[2-(4-morpholinyl)ethyl] |
| N-cyclohexyl-N'-(3,4-dichloro-phenyl)-urea |
| N-Cyclohexyl-N'-(3,4-dichlor-phenyl)-harnstoff |
| 1-cyclohexyl-3-(2-morpholin-4-yl-ethyl)-urea |
| 1-CYCLOHEXYL-3-(3,4-DICHLORO-PHENYL)-UREA |
| N-Cyclohexyl-N'-(2-morpholinoethyl)harnstoff |