(R)-4-tert-butoxy-2-(cyclopentylmethyl)-4-oxobutanoic acid
Modify Date: 2025-09-13 13:42:17
(R)-4-tert-butoxy-2-(cyclopentylmethyl)-4-oxobutanoic acid structure
|
Common Name | (R)-4-tert-butoxy-2-(cyclopentylmethyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 204637-77-4 | Molecular Weight | 255.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-2-(cyclopentylmethyl)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H23O4 |
|---|---|
| Molecular Weight | 255.33000 |
| Exact Mass | 255.16000 |
| PSA | 66.43000 |
| LogP | 1.66460 |
| InChIKey | XJAASFPIJJMEQF-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)CC(CC1CCCC1)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butanedioic acid,(cyclopentylmethyl)-,4-(1,1-dimethylethyl) ester,(2R) |