(R)-6-(3-Methoxy-phenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one
Modify Date: 2026-06-26 18:20:53
![(R)-6-(3-Methoxy-phenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one Structure](https://www.chemsrc.com/extcaspic/009/204841-72-5.png)
(R)-6-(3-Methoxy-phenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one structure
|
Common Name | (R)-6-(3-Methoxy-phenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one | ||
|---|---|---|---|---|
| CAS Number | 204841-72-5 | Molecular Weight | 297.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-6-(3-Methoxy-phenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
|---|
| Molecular Formula | C17H15NO4 |
|---|---|
| Molecular Weight | 297.3 |
| InChIKey | IIXRKOHTDRHQQN-CYBMUJFWSA-N |
| SMILES | COC1=CC=CC(=C1)[C@H]2CC(=O)C3=CC4=C(C=C3N2)OCO4 |
|
Name: Cytotoxicity against human breast cancer cells (MCF-7) using SRB assay.
Source: ChEMBL
Target: MCF7
External Id: CHEMBL707437
|
|
Name: Cytotoxicity against human epidermoid carcinoma of the nasopharyngeal cells (KB) usin...
Source: ChEMBL
Target: KB
External Id: CHEMBL705641
|
|
Name: Inhibition of bovine brain tubulin polymerization (ITP).
Source: ChEMBL
Target: Tubulin beta-2B chain
External Id: CHEMBL815874
|
|
Name: Inhibition of tubulin polymerization interacting at the colchicine binding site.
Source: ChEMBL
Target: Tubulin alpha-1A chain
External Id: CHEMBL817769
|
|
Name: Cytotoxicity against human lung carcinoma cells (A-549) using SRB assay.
Source: ChEMBL
Target: A549
External Id: CHEMBL624706
|
|
Name: Cytotoxicity against human ileocecal carcinoma cells (HCT-8) using SRB assay.
Source: ChEMBL
Target: HCT-8
External Id: CHEMBL685740
|
|
Name: Cytotoxicity against human renal cancer cells (CAKI-1) using SRB assay.
Source: ChEMBL
Target: CAKI-1
External Id: CHEMBL651849
|
Total 7, Current Page 1 of 1
1