BIIL260 structure
|
Common Name | BIIL260 | ||
|---|---|---|---|---|
| CAS Number | 204974-93-6 | Molecular Weight | 466.57100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H30N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BIIL260BIIL260 is the active metabolite of BIIL284, shows high affinity to LTB4 receptor on isolated human neutrophil cell membranes with Ki of 1.7 nM. |
| Name | 4-[[3-[[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]methyl]phenyl]methoxy]benzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H30N2O3 |
|---|---|
| Molecular Weight | 466.57100 |
| Exact Mass | 466.22600 |
| PSA | 88.56000 |
| LogP | 6.96020 |
| InChIKey | MBLJFKQACMILLC-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(OCc2cccc(COc3ccc(C(=N)N)cc3)c2)cc1 |
| unii-p3c87zbo3k |
| biil 260 |
| BIIL260 |