N'-(4,5-Diphenyl-2-oxazolyl)-N,N-dimethyl-1,3-propanediamine structure
|
Common Name | N'-(4,5-Diphenyl-2-oxazolyl)-N,N-dimethyl-1,3-propanediamine | ||
|---|---|---|---|---|
| CAS Number | 20503-85-9 | Molecular Weight | 321.41600 | |
| Density | 1.113g/cm3 | Boiling Point | 445.2ºC at 760 mmHg | |
| Molecular Formula | C20H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223ºC | |
| Name | N-(4,5-diphenyl-1,3-oxazol-2-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 445.2ºC at 760 mmHg |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.41600 |
| Flash Point | 223ºC |
| Exact Mass | 321.18400 |
| PSA | 44.53000 |
| LogP | 3.79410 |
| Vapour Pressure | 4.03E-08mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | OUGWHDLNULSJCN-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| HS Code | 2934999090 |
|---|
|
~%
N'-(4,5-Dipheny... CAS#:20503-85-9 |
| Literature: Marchetti; Mattalia; Rosnati Journal of medicinal chemistry, 1968 , vol. 11, # 5 p. 1092 - 1093 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |