3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine
Modify Date: 2025-09-10 08:28:40
![3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine Structure](https://www.chemsrc.com/extcaspic/413/2050525-56-7.png)
3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine structure
|
Common Name | 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2050525-56-7 | Molecular Weight | 244.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9ClN4 |
|---|---|
| Molecular Weight | 244.68 |
| InChIKey | AYWXQGHPQPPXKS-UHFFFAOYSA-N |
| SMILES | Cn1cc(-c2ccnc(Cl)n2)c2ncccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine? |
| A: CAS number of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine is 2050525-56-7. |
| Q: What is the Chinese name of 2050525-56-7? |
| A: Chinese name of 2050525-56-7 is 2050525-56-7. |
| Q: What is the SMILES notation of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine? |
| A: SMILES notation of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine is Cn1cc(-c2ccnc(Cl)n2)c2ncccc21. |
| Q: What is the molecular weight of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine? |
| A: Molecular weight of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine is 244.68. |
| Q: What is the InChIKey of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine? |
| A: InChIKey of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine is AYWXQGHPQPPXKS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine? |
| A: Molecular formula of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine is C12H9ClN4. |
| Q: What is the English name of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine? |
| A: The English name of 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine is 3-(2-Chloropyrimidin-4-YL)-1-methyl-1H-pyrrolo[3,2-B]pyridine. |