2'-MeCCPA structure
|
Common Name | 2'-MeCCPA | ||
|---|---|---|---|---|
| CAS Number | 205171-12-6 | Molecular Weight | 383.83000 | |
| Density | 1.76g/cm3 | Boiling Point | 643.3ºC at 760 mmHg | |
| Molecular Formula | C16H22ClN5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.9ºC | |
Use of 2'-MeCCPA2'-MeCCPA is a potent and selective A1 adenosine receptors (A1AR) agonist. 2'-MeCCPA efficiently inhibits cAMP modulation in both direct pathway medium spiny neurons (dMSNs) and indirect pathway medium spiny neurons (iMSNs)[1][2]. |
| Name | 2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-MeCCPA is a potent and selective A1 adenosine receptors (A1AR) agonist. 2'-MeCCPA efficiently inhibits cAMP modulation in both direct pathway medium spiny neurons (dMSNs) and indirect pathway medium spiny neurons (iMSNs)[1][2]. |
|---|---|
| Related Catalog | |
| Target |
A1AR |
| In Vivo | 2’-MeCCPA (1 nM-1 M) at reperfusion significantly reduces infarct size to risk ratio in male Sprague-Dawley rats[1]. |
| References |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 643.3ºC at 760 mmHg |
| Molecular Formula | C16H22ClN5O4 |
| Molecular Weight | 383.83000 |
| Flash Point | 342.9ºC |
| Exact Mass | 383.13600 |
| PSA | 114.55000 |
| LogP | 1.17280 |
| Vapour Pressure | 1.98E-17mmHg at 25°C |
| Index of Refraction | 1.777 |
| InChIKey | MMPAUXMIDJWGFO-UHFFFAOYSA-N |
| SMILES | CC1(O)C(O)C(CO)OC1n1cnc2c(NC3CCCC3)nc(Cl)nc21 |
| HMS3268H12 |
| 2'-IODO-2-PHENYLACETOPHENONE |
| 2-chloro-2'-C-methyl-N6-cyclopentyl-adenosine |