(1-dimethoxyphosphoryl-2-methyl-prop-1-enyl) 2-bromo-2-methyl-propanoate structure
|
Common Name | (1-dimethoxyphosphoryl-2-methyl-prop-1-enyl) 2-bromo-2-methyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 20521-92-0 | Molecular Weight | 329.12500 | |
| Density | 1.369g/cm3 | Boiling Point | 353ºC at 760 mmHg | |
| Molecular Formula | C10H18BrO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | (1-dimethoxyphosphoryl-2-methylprop-1-enyl) 2-bromo-2-methylpropanoate |
|---|
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 353ºC at 760 mmHg |
| Molecular Formula | C10H18BrO5P |
| Molecular Weight | 329.12500 |
| Flash Point | 167.3ºC |
| Exact Mass | 328.00800 |
| PSA | 71.64000 |
| LogP | 3.44040 |
| Vapour Pressure | 3.68E-05mmHg at 25°C |
| Index of Refraction | 1.477 |
| InChIKey | PPWNXHIALZSXAF-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(OC(=O)C(C)(C)Br)=C(C)C |
|
~%
(1-dimethoxypho... CAS#:20521-92-0 |
| Literature: Bentrude,W.G.; Johnson,W.D. Journal of the American Chemical Society, 1968 , vol. 90, p. 5924 - 5926 |
|
~%
(1-dimethoxypho... CAS#:20521-92-0 |
| Literature: Bentrude,W.G. et al. Journal of the American Chemical Society, 1972 , vol. 94, p. 3058 - 3067 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |