Propanoicacid, 2-methyl-2-[(1-thioxoethyl)thio]-,1-(dimethoxyphosphinyl)-2-methyl-1-propen-1-yl ester structure
|
Common Name | Propanoicacid, 2-methyl-2-[(1-thioxoethyl)thio]-,1-(dimethoxyphosphinyl)-2-methyl-1-propen-1-yl ester | ||
|---|---|---|---|---|
| CAS Number | 20521-93-1 | Molecular Weight | 340.39600 | |
| Density | 1.219g/cm3 | Boiling Point | 421.1ºC at 760mmHg | |
| Molecular Formula | C12H21O5PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.5ºC | |
| Name | (1-dimethoxyphosphoryl-2-methylprop-1-enyl) 2-ethanethioylsulfanyl-2-methylpropanoate |
|---|
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 421.1ºC at 760mmHg |
| Molecular Formula | C12H21O5PS2 |
| Molecular Weight | 340.39600 |
| Flash Point | 208.5ºC |
| Exact Mass | 340.05700 |
| PSA | 129.03000 |
| LogP | 4.12600 |
| Vapour Pressure | 2.67E-07mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | MWJKHLPVZCFUIG-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)C(OC(=O)C(C)(C)SC(C)=S)=C(C)C |
|
~%
Propanoicacid, ... CAS#:20521-93-1 |
| Literature: Bentrude,W.G.; Johnson,W.D. Journal of the American Chemical Society, 1968 , vol. 90, p. 5924 - 5926 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |