1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hepta-2,5-diene structure
|
Common Name | 1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hepta-2,5-diene | ||
|---|---|---|---|---|
| CAS Number | 20524-59-8 | Molecular Weight | 333.25400 | |
| Density | 1.89g/cm3 | Boiling Point | 319.4ºC at 760 mmHg | |
| Molecular Formula | C7HCl7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.8ºC | |
| Name | 1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 319.4ºC at 760 mmHg |
| Molecular Formula | C7HCl7 |
| Molecular Weight | 333.25400 |
| Flash Point | 147.8ºC |
| Exact Mass | 329.79000 |
| LogP | 4.95460 |
| Vapour Pressure | 0.000635mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | NSLUNJDAHOVMDS-UHFFFAOYSA-N |
| SMILES | ClC1=CC2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| HS Code | 2903890090 |
|---|
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Heptachlornorbornadien |