4-Chloro-2,N-dimethoxy-N-methyl-benzamide structure
|
Common Name | 4-Chloro-2,N-dimethoxy-N-methyl-benzamide | ||
|---|---|---|---|---|
| CAS Number | 205320-02-1 | Molecular Weight | 229.660 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 388.0±32.0 °C at 760 mmHg | |
| Molecular Formula | C10H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4±25.1 °C | |
| Name | 4-Chloro-N,2-dimethoxy-N-methylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 388.0±32.0 °C at 760 mmHg |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.660 |
| Flash Point | 188.4±25.1 °C |
| Exact Mass | 229.050568 |
| PSA | 38.77000 |
| LogP | 2.16 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | FBQWJRHUICABKO-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)ccc1C(=O)N(C)OC |
|
~%
4-Chloro-2,N-di... CAS#:205320-02-1 |
| Literature: US2005/209274 A1, ; Page/Page column 21 ; US 20050209274 A1 |
|
~%
4-Chloro-2,N-di... CAS#:205320-02-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 49, # 22 p. 6569 - 6584 |
| Benzamide, 4-chloro-N,2-dimethoxy-N-methyl- |
| 4-Chloro-N,2-dimethoxy-N-methylbenzamide |