N,N'-dihydroxy-N,N'-diphenylbutanediamide structure
|
Common Name | N,N'-dihydroxy-N,N'-diphenylbutanediamide | ||
|---|---|---|---|---|
| CAS Number | 20533-09-9 | Molecular Weight | 300.30900 | |
| Density | N/A | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264ºC | |
| Name | N,N'-dihydroxy-N,N'-diphenylbutanediamide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 513ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.30900 |
| Flash Point | 264ºC |
| Exact Mass | 300.11100 |
| PSA | 81.08000 |
| LogP | 2.61140 |
| Vapour Pressure | 2.39E-11mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | FLAKPGYLHFDAPW-UHFFFAOYSA-N |
| SMILES | O=C(CCC(=O)N(O)c1ccccc1)N(O)c1ccccc1 |
|
~%
N,N'-dihydroxy-... CAS#:20533-09-9 |
| Literature: Das, M. K.; Bose, P.; Roy, N. Journal of Chemical & Engineering Data, 1984 , vol. 29, # 3 p. 345 - 348 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Butanediamide,N,N'-dihydroxy-N,N'-diphenyl |
| succinyl bis-N-phenylhydroxamic acid |
| Succinylbisphenylhydroxylamin |