(1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) structure
|
Common Name | (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) | ||
|---|---|---|---|---|
| CAS Number | 2053652-16-5 | Molecular Weight | 238.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N2 |
|---|---|
| Molecular Weight | 238.33 |
| InChIKey | MJXWCWQYAVHEDE-CVEARBPZSA-N |
| SMILES | NC1CCC(N)c2cc(-c3ccccc3)ccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic)? |
| A: Molecular formula of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) is C16H18N2. |
| Q: What is the Chinese name of 2053652-16-5? |
| A: Chinese name of 2053652-16-5 is 2053652-16-5. |
| Q: What is the CAS number of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic)? |
| A: CAS number of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) is 2053652-16-5. |
| Q: What is the SMILES notation of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic)? |
| A: SMILES notation of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) is NC1CCC(N)c2cc(-c3ccccc3)ccc21. |
| Q: What is the English name of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic)? |
| A: The English name of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) is (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic). |
| Q: What is the molecular weight of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic)? |
| A: Molecular weight of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) is 238.33. |
| Q: What is the InChIKey of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic)? |
| A: InChIKey of (1R,4S)-6-phenyl-1,2,3,4-tetrahydronaphthalene-1,4-diamine (racemic) is MJXWCWQYAVHEDE-CVEARBPZSA-N. |