N,N'-bis(pyridin-4-ylmethyl)oxamide structure
|
Common Name | N,N'-bis(pyridin-4-ylmethyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 205386-51-2 | Molecular Weight | 270.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-bis(pyridin-4-ylmethyl)oxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N4O2 |
|---|---|
| Molecular Weight | 270.28700 |
| Exact Mass | 270.11200 |
| PSA | 83.98000 |
| LogP | 1.19100 |
| InChIKey | IMFIKLLSTFRMNN-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccncc1)C(=O)NCc1ccncc1 |
|
~81%
N,N'-bis(pyridi... CAS#:205386-51-2 |
| Literature: Ouyang, Xi; Fowler, Frank W.; Lauher, Joseph W. Journal of the American Chemical Society, 2003 , vol. 125, # 41 p. 12400 - 12401 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-bis-4-methylpyridyl oxalamide |
| HMS2727K20 |
| 4-pyridyl-CH2NHCOCONHCH2-4-pyridyl |