5,5'-Dimethyl-4,4'-bipyrimidine-2,2',6(1H,1'H,3H)-trione structure
|
Common Name | 5,5'-Dimethyl-4,4'-bipyrimidine-2,2',6(1H,1'H,3H)-trione | ||
|---|---|---|---|---|
| CAS Number | 20545-68-0 | Molecular Weight | 234.21100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-6-(5-methyl-2-oxo-1H-pyrimidin-6-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N4O3 |
|---|---|
| Molecular Weight | 234.21100 |
| Exact Mass | 234.07500 |
| PSA | 112.25000 |
| LogP | 0.66720 |
| InChIKey | IGTSGPZXQJVUAM-UHFFFAOYSA-N |
| SMILES | Cc1cnc(=O)[nH]c1-c1[nH]c(=O)[nH]c(=O)c1C |
| HS Code | 2933599090 |
|---|
|
~%
5,5'-Dimethyl-4... CAS#:20545-68-0 |
| Literature: Shetlar, Martin D.; Chung, Janet Photochemistry and Photobiology, 2011 , vol. 87, # 4 p. 802 - 817 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-4'-<5'-methylpyrimidin-2'-one>-thymine |