Azido-PEG3-Val-Cit-PAB-PNP structure
|
Common Name | Azido-PEG3-Val-Cit-PAB-PNP | ||
|---|---|---|---|---|
| CAS Number | 2055047-18-0 | Molecular Weight | 773.79 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H47N9O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG3-Val-Cit-PAB-PNPAzido-PEG3-Val-Cit-PAB-PNP is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azido-PEG3-Val-Cit-PAB-PNP is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[2]. |
| Name | Azido-PEG3-Val-Cit-PAB-PNP |
|---|
| Description | Azido-PEG3-Val-Cit-PAB-PNP is a cleavable 3 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. Azido-PEG3-Val-Cit-PAB-PNP is also a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[2]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Molecular Formula | C34H47N9O12 |
|---|---|
| Molecular Weight | 773.79 |
| InChIKey | HLBCDJANEWKOSX-JDXGNMNLSA-N |
| SMILES | CC(C)C(NC(=O)CCOCCOCCOCCN=[N+]=[N-])C(=O)NC(CCCNC(N)=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| Storage condition | 2-8°C |