N-(2-Azidoethyl)betulonamide
Modify Date: 2024-02-07 22:54:00
N-(2-Azidoethyl)betulonamide structure
|
Common Name | N-(2-Azidoethyl)betulonamide | ||
|---|---|---|---|---|
| CAS Number | 2055270-64-7 | Molecular Weight | 522.778 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H50N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-(2-Azidoethyl)betulonamideN-(2-Azidoethyl)betulonamide is a pentacyclic triterpenoid, a derivative of betulonic acid , and an intermediate in the synthesis of betulonic acid derivatives within vitrocancer cell cytotoxicity.1 |
| Name | N-(2-Azidoethyl)betulonamide |
|---|
| Description | N-(2-Azidoethyl)betulonamide is a pentacyclic triterpenoid, a derivative of betulonic acid , and an intermediate in the synthesis of betulonic acid derivatives within vitrocancer cell cytotoxicity.1 |
|---|---|
| References | 1. Suman, P., Patel, A., Solano, L., et al.Synthesis and cytotoxicity of Baylis-Hillman template derived betulinic acid-triazole conjugatesTetrahedron73(29)4214-4226(2017) |
| Molecular Formula | C32H50N4O2 |
|---|---|
| Molecular Weight | 522.778 |
| InChIKey | XWDYQHIFHAUHJG-GKMZBMDBSA-N |
| SMILES | C=C(C)C1CCC2(C(=O)NCCN=[N+]=[N-])CCC3(C)C(CCC4C5(C)CCC(=O)C(C)(C)C5CCC43C)C12 |