(S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate
Modify Date: 2026-07-03 12:03:54
(S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate structure
|
Common Name | (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2055849-11-9 | Molecular Weight | 211.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15F2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H15F2NO3 |
|---|---|
| Molecular Weight | 211.21 |
| InChIKey | NLSRUOLFFBDDOB-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)C(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate? |
| A: The English name of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate is (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate. |
| Q: What is the Chinese name of 2055849-11-9? |
| A: Chinese name of 2055849-11-9 is 2055849-11-9. |
| Q: What is the molecular formula of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate? |
| A: Molecular formula of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate is C8H15F2NO3. |
| Q: What is the SMILES notation of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate? |
| A: SMILES notation of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate is CC(C)(C)OC(=O)NC(CO)C(F)F. |
| Q: What is the CAS number of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate? |
| A: CAS number of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate is 2055849-11-9. |
| Q: What is the molecular weight of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate? |
| A: Molecular weight of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate is 211.21. |
| Q: What is the InChIKey of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate? |
| A: InChIKey of (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate is NLSRUOLFFBDDOB-YFKPBYRVSA-N. |