Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate
Modify Date: 2026-07-10 09:21:20
Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate structure
|
Common Name | Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate | ||
|---|---|---|---|---|
| CAS Number | 2055939-76-7 | Molecular Weight | 905.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C57H112N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C57H112N2O5 |
|---|---|
| Molecular Weight | 905.5 |
| InChIKey | OBLOMQLYESVEMF-UHFFFAOYSA-N |
| SMILES | CCCCCCC(CCCC)COC(=O)CCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)N(CCCN(C)C)C(=O)C(CC)CCCCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate? |
| A: InChIKey of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate is OBLOMQLYESVEMF-UHFFFAOYSA-N. |
| Q: What is the English name of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate? |
| A: The English name of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate is Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate. |
| Q: What is the molecular formula of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate? |
| A: Molecular formula of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate is C57H112N2O5. |
| Q: What is the Chinese name of 2055939-76-7? |
| A: Chinese name of 2055939-76-7 is 2055939-76-7. |
| Q: What is the CAS number of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate? |
| A: CAS number of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate is 2055939-76-7. |
| Q: What is the molecular weight of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate? |
| A: Molecular weight of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate is 905.5. |
| Q: What is the SMILES notation of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate? |
| A: SMILES notation of Bis(2-butyloctyl) 10-(N-(3-(dimethylamino)propyl)-2-ethylheptanamido)nonadecanedioate is CCCCCCC(CCCC)COC(=O)CCCCCCCCC(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)N(CCCN(C)C)C(=O)C(CC)CCCCC. |