4-benzyl-1-(4-methylphenyl)sulfonylpiperidine
4-benzyl-1-(4-methylphenyl)sulfonylpiperidine structure
|
Common Name | 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 205641-99-2 | Molecular Weight | 329.45600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H23NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H23NO2S |
|---|---|
| Molecular Weight | 329.45600 |
| Exact Mass | 329.14500 |
| PSA | 45.76000 |
| LogP | 4.65710 |
| InChIKey | UMUAEIKEGIYZRB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-benzyl-1-(4-m... CAS#:205641-99-2 |
| Literature: SIGNA CHEMISTRY, LLC Patent: US2009/306391 A1, 2009 ; Location in patent: Page/Page column 7 ; |
|
~%
4-benzyl-1-(4-m... CAS#:205641-99-2 |
| Literature: Furman, Bartlomiej; Dziedzic, Magdalena Tetrahedron Letters, 2003 , vol. 44, # 45 p. 8249 - 8252 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-benzyl-N-posylpiperidine |
| 4-benzyl-1-tosylpiperidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: Polar surface area (PSA) of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is 45.76000. |
| Q: What is the InChIKey of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: InChIKey of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is UMUAEIKEGIYZRB-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: LogP of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is 4.65710. |
| Q: What is the English name of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: The English name of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine. |
| Q: What is the molecular weight of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: Molecular weight of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is 329.45600. |
| Q: What English synonyms does 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine have? |
| A: English synonyms of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine: 4-benzyl-N-posylpiperidine, 4-benzyl-1-tosylpiperidine. |
| Q: What is the SMILES notation of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: SMILES notation of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is Cc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)cc1. |
| Q: What is the CAS number of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: CAS number of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is 205641-99-2. |
| Q: What is the molecular formula of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine? |
| A: Molecular formula of 4-benzyl-1-(4-methylphenyl)sulfonylpiperidine is C19H23NO2S. |